C21H13F9N6O2 — CID 90445999
2-[[[2-[1-[(2,3-difluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5-fluoropyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90445999) has the molecular formula C21H13F9N6O2 and a molecular weight of 552.36 g/mol. Its IUPAC name is 2-[[[2-[1-[(2,3-difluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5-fluoropyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[[2-[1-[(2,3-difluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5-fluoropyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90445999 |
| Molecular Formula | C21H13F9N6O2 |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-[[[2-[1-[(2,3-difluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5-fluoropyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CNc1nc(-c2cc(-c3ccon3)n(Cc3cccc(F)c3F)n2)ncc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H13F9N6O2/c22-11-3-1-2-10(16(11)24)8-36-15(13-4-5-38-35-13)6-14(34-36)18-31-7-12(23)17(33-18)32-9-19(37,20(25,26)27)21(28,29)30/h1-7,37H,8-9H2,(H,31,32,33) |
| InChIKey | JORBTWFMZHYAHG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |