C21H15F7N6O2 — CID 90446009
1,1,1,3,3,3-hexafluoro-2-[[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol (PubChem CID 90446009) has the molecular formula C21H15F7N6O2 and a molecular weight of 516.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 90446009 |
| Molecular Formula | C21H15F7N6O2 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-ol |
| SMILES | OC(CNc1ccnc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)n1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H15F7N6O2/c22-13-4-2-1-3-12(13)10-34-16(14-6-8-36-33-14)9-15(32-34)18-29-7-5-17(31-18)30-11-19(35,20(23,24)25)21(26,27)28/h1-9,35H,10-11H2,(H,29,30,31) |
| InChIKey | IAUKMIATAJXYTB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |