C18H30N4O5 — CID 90446799
6-O-tert-butyl 7-O-methyl (7S)-4-(butoxyamino)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6,7-dicarboxylate (PubChem CID 90446799) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-O-tert-butyl 7-O-methyl (7S)-4-(butoxyamino)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6,7-dicarboxylate.
| Compound Name | 6-O-tert-butyl 7-O-methyl (7S)-4-(butoxyamino)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 90446799 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 6-O-tert-butyl 7-O-methyl (7S)-4-(butoxyamino)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6,7-dicarboxylate |
| SMILES | CCCCONC1CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC)c2c1cnn2C |
| InChI | InChI=1S/C18H30N4O5/c1-7-8-9-26-20-13-11-22(17(24)27-18(2,3)4)15(16(23)25-6)14-12(13)10-19-21(14)5/h10,13,15,20H,7-9,11H2,1-6H3/t13?,15-/m0/s1 |
| InChIKey | FOOVLDFCQLPQEB-WUJWULDRSA-N |
| XLogP | 2.25 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|