C14H16N4 — CID 90447086
(Z)-1,4-bis(1,2-dihydropyridin-6-yl)but-2-ene-1,4-diimine (PubChem CID 90447086) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is (Z)-1,4-bis(1,2-dihydropyridin-6-yl)but-2-ene-1,4-diimine.
| Compound Name | (Z)-1,4-bis(1,2-dihydropyridin-6-yl)but-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 90447086 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (Z)-1,4-bis(1,2-dihydropyridin-6-yl)but-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])C1=CC=CCN1)C1=CC=CCN1 |
| InChI | InChI=1S/C14H16N4/c15-11(13-5-1-3-9-17-13)7-8-12(16)14-6-2-4-10-18-14/h1-8,15-18H,9-10H2/b8-7-,15-11-,16-12- |
| InChIKey | HNSDSRJVZOJFGS-YZNRNGPMSA-N |
| XLogP | 1.67 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|