C17H24N2O2 — CID 90447094
6-[[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-6-yl]methyl]-3,4-dihydro-2H-1,3-benzoxazine (PubChem CID 90447094) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 6-[[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-6-yl]methyl]-3,4-dihydro-2H-1,3-benzoxazine.
| Compound Name | 6-[[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-6-yl]methyl]-3,4-dihydro-2H-1,3-benzoxazine |
|---|---|
| PubChem CID | 90447094 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-[[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-6-yl]methyl]-3,4-dihydro-2H-1,3-benzoxazine |
| SMILES | c1cc2c(cc1CC1CC[C@H]3OCNCC3C1)CNCO2 |
| InChI | InChI=1S/C17H24N2O2/c1-3-16-14(8-18-10-20-16)6-12(1)5-13-2-4-17-15(7-13)9-19-11-21-17/h1,3,6,13,15,17-19H,2,4-5,7-11H2/t13?,15?,17-/m1/s1 |
| InChIKey | KSALZIKLWWVWBP-PUJMQQBBSA-N |
| XLogP | 2.03 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |