C31H39NO3S — CID 90447492
1,2-dimethoxy-4-methyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one (PubChem CID 90447492) has the molecular formula C31H39NO3S and a molecular weight of 505.72 g/mol. Its IUPAC name is 1,2-dimethoxy-4-methyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one.
| Compound Name | 1,2-dimethoxy-4-methyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one |
|---|---|
| PubChem CID | 90447492 |
| Molecular Formula | C31H39NO3S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 1,2-dimethoxy-4-methyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one |
| SMILES | COc1c2nc3cc(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)ccc3sc-2c(C)c(=O)c1OC |
| InChI | InChI=1S/C31H39NO3S/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-24-17-18-26-25(19-24)32-27-29(34-6)30(35-7)28(33)23(5)31(27)36-26/h11,13,15,17-19H,8-10,12,14,16H2,1-7H3/b21-13+,22-15+ |
| InChIKey | XRPQDGOBJCZGFI-NTZRDTQNSA-N |
| XLogP | 8.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|