About tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate
tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate (PubChem CID 90447581) has the molecular formula C14H22F3NO3
and a molecular weight of 309.33 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate |
| PubChem CID | 90447581 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(/C=C/CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H22F3NO3/c1-12(2,3)21-11(19)18-9-7-13(20,8-10-18)5-4-6-14(15,16)17/h4-5,20H,6-10H2,1-3H3/b5-4+ |
| InChIKey | GCCDLJLQRNOCKG-SNAWJCMRSA-N |
| XLogP | 3.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate (CID 90447581) is tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(O)(/C=C/CC(F)(F)F)CC1.
What is the InChIKey of tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate?
The InChIKey is GCCDLJLQRNOCKG-SNAWJCMRSA-N. The full InChI is InChI=1S/C14H22F3NO3/c1-12(2,3)21-11(19)18-9-7-13(20,8-10-18)5-4-6-14(15,16)17/h4-5,20H,6-10H2,1-3H3/b5-4+.
What are the key properties of tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate?
tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate has a molecular weight of 309.33 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carboxylate is sourced from PubChem (CID 90447581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).