C28H26F3N3O4S — CID 90447694
N-[(2Z,4E)-4-[4-(2,3-difluorophenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trienyl]-5-fluoroquinoline-8-sulfonamide (PubChem CID 90447694) has the molecular formula C28H26F3N3O4S and a molecular weight of 557.59 g/mol. Its IUPAC name is N-[(2Z,4E)-4-[4-(2,3-difluorophenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trienyl]-5-fluoroquinoline-8-sulfonamide.
| Compound Name | N-[(2Z,4E)-4-[4-(2,3-difluorophenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trienyl]-5-fluoroquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 90447694 |
| Molecular Formula | C28H26F3N3O4S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[(2Z,4E)-4-[4-(2,3-difluorophenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trienyl]-5-fluoroquinoline-8-sulfonamide |
| SMILES | C=C/C=C(\C=C/CNS(=O)(=O)c1ccc(F)c2cccnc12)C(=O)N1CCC(O)(c2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C28H26F3N3O4S/c1-2-6-19(27(35)34-17-13-28(36,14-18-34)21-9-3-10-23(30)25(21)31)7-4-16-33-39(37,38)24-12-11-22(29)20-8-5-15-32-26(20)24/h2-12,15,33,36H,1,13-14,16-18H2/b7-4-,19-6+ |
| InChIKey | IVCLIMZIJXYMKT-CQKLJWTNSA-N |
| XLogP | 4.11 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|