C30H33N3O5S — CID 90447758
N-[(2E,4E)-4-(4-benzyl-4-hydroxypiperidine-1-carbonyl)-3-methoxyhepta-2,4,6-trienyl]quinoline-8-sulfonamide (PubChem CID 90447758) has the molecular formula C30H33N3O5S and a molecular weight of 547.68 g/mol. Its IUPAC name is N-[(2E,4E)-4-(4-benzyl-4-hydroxypiperidine-1-carbonyl)-3-methoxyhepta-2,4,6-trienyl]quinoline-8-sulfonamide.
| Compound Name | N-[(2E,4E)-4-(4-benzyl-4-hydroxypiperidine-1-carbonyl)-3-methoxyhepta-2,4,6-trienyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 90447758 |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | N-[(2E,4E)-4-(4-benzyl-4-hydroxypiperidine-1-carbonyl)-3-methoxyhepta-2,4,6-trienyl]quinoline-8-sulfonamide |
| SMILES | C=C/C=C(C(=O)N1CCC(O)(Cc2ccccc2)CC1)\C(=C/CNS(=O)(=O)c1cccc2cccnc12)OC |
| InChI | InChI=1S/C30H33N3O5S/c1-3-9-25(29(34)33-20-16-30(35,17-21-33)22-23-10-5-4-6-11-23)26(38-2)15-19-32-39(36,37)27-14-7-12-24-13-8-18-31-28(24)27/h3-15,18,32,35H,1,16-17,19-22H2,2H3/b25-9+,26-15+ |
| InChIKey | QVSAPIAYUOPBBJ-JTVXICFHSA-N |
| XLogP | 3.75 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|