C15H18ClF3N4O — CID 90447811
N-[5-chloro-6-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-3,3-dimethylbutanamide (PubChem CID 90447811) has the molecular formula C15H18ClF3N4O and a molecular weight of 362.78 g/mol. Its IUPAC name is N-[5-chloro-6-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[5-chloro-6-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90447811 |
| Molecular Formula | C15H18ClF3N4O |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[5-chloro-6-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc2nc(NC(=O)CC(C)(C)C)n(CC(F)(F)F)c2nc1Cl |
| InChI | InChI=1S/C15H18ClF3N4O/c1-8-5-9-12(22-11(8)16)23(7-15(17,18)19)13(20-9)21-10(24)6-14(2,3)4/h5H,6-7H2,1-4H3,(H,20,21,24) |
| InChIKey | AFXXXIIDRBHNKA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|