C16H16F6N4O2 — CID 90447971
N-[3-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 90447971) has the molecular formula C16H16F6N4O2 and a molecular weight of 410.32 g/mol. Its IUPAC name is N-[3-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[3-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 90447971 |
| Molecular Formula | C16H16F6N4O2 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[3-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)Nc1nc2ccc(C(F)(F)F)nc2n1C1CCC1 |
| InChI | InChI=1S/C16H16F6N4O2/c17-15(18,19)8-28-7-6-12(27)25-14-23-10-4-5-11(16(20,21)22)24-13(10)26(14)9-2-1-3-9/h4-5,9H,1-3,6-8H2,(H,23,25,27) |
| InChIKey | QTGCZQMIMDFSQL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|