C18H25ClN4O2 — CID 90448087
N-(5-chloro-3-cyclobutyl-5,6-dihydroimidazo[4,5-b]pyridin-2-yl)-2-(5,5-dimethyloxolan-2-yl)acetamide (PubChem CID 90448087) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is N-(5-chloro-3-cyclobutyl-5,6-dihydroimidazo[4,5-b]pyridin-2-yl)-2-(5,5-dimethyloxolan-2-yl)acetamide.
| Compound Name | N-(5-chloro-3-cyclobutyl-5,6-dihydroimidazo[4,5-b]pyridin-2-yl)-2-(5,5-dimethyloxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 90448087 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-(5-chloro-3-cyclobutyl-5,6-dihydroimidazo[4,5-b]pyridin-2-yl)-2-(5,5-dimethyloxolan-2-yl)acetamide |
| SMILES | CC1(C)CCC(CC(=O)Nc2nc3c(n2C2CCC2)=NC(Cl)CC=3)O1 |
| InChI | InChI=1S/C18H25ClN4O2/c1-18(2)9-8-12(25-18)10-15(24)22-17-20-13-6-7-14(19)21-16(13)23(17)11-4-3-5-11/h6,11-12,14H,3-5,7-10H2,1-2H3,(H,20,22,24) |
| InChIKey | KMCDWUZMEALAKT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|