C24H19IN4O — CID 90448939
4-[3-iodo-1-[phenyl(pyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 90448939) has the molecular formula C24H19IN4O and a molecular weight of 506.35 g/mol. Its IUPAC name is 4-[3-iodo-1-[phenyl(pyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[3-iodo-1-[phenyl(pyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90448939 |
| Molecular Formula | C24H19IN4O |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 4-[3-iodo-1-[phenyl(pyridin-2-yl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(I)cn(C(c3ccccc3)c3ccccn3)c2c1 |
| InChI | InChI=1S/C24H19IN4O/c1-15-22(16(2)30-28-15)18-12-21-23(27-13-18)19(25)14-29(21)24(17-8-4-3-5-9-17)20-10-6-7-11-26-20/h3-14,24H,1-2H3 |
| InChIKey | OJLKBDFOFNMUDH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|