C29H33N3O3 — CID 90449042
1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol (PubChem CID 90449042) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol.
| Compound Name | 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol |
|---|---|
| PubChem CID | 90449042 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2cn(CC3(C)CCCCC3)c3cc(-c4c(C)noc4C)cnc23)cc1OC |
| InChI | InChI=1S/C29H33N3O3/c1-18-27(20(3)35-31-18)22-13-25-28(30-15-22)24(16-32(25)17-29(4)11-7-6-8-12-29)21-9-10-23(19(2)33)26(14-21)34-5/h9-10,13-16,33H,2,6-8,11-12,17H2,1,3-5H3 |
| InChIKey | RDUBMWUAYDGSRP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|