C16H18F3N3O6 — CID 90449118
2,2,2-trifluoro-N-[5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynyl]acetamide (PubChem CID 90449118) has the molecular formula C16H18F3N3O6 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynyl]acetamide |
|---|---|
| PubChem CID | 90449118 |
| Molecular Formula | C16H18F3N3O6 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynyl]acetamide |
| SMILES | O=C(NCCCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O6/c17-16(18,19)15(25)20-5-3-1-2-4-10-6-13(22(26)27)21(8-10)14-7-11(24)12(9-23)28-14/h6,8,11-12,14,23-24H,1,3,5,7,9H2,(H,20,25)/t11-,12+,14+/m0/s1 |
| InChIKey | SSFYORWDYPOTKA-OUCADQQQSA-N |
| XLogP | 0.85 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|