C14H22N3O15P3 — CID 90449120
[[1-amino-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90449120) has the molecular formula C14H22N3O15P3 and a molecular weight of 565.26 g/mol. Its IUPAC name is [[1-amino-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[1-amino-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90449120 |
| Molecular Formula | C14H22N3O15P3 |
| Molecular Weight | 565.26 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | [[1-amino-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(CCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C14H22N3O15P3/c15-12(30-34(25,26)32-35(27,28)31-33(22,23)24)4-2-1-3-9-5-13(17(20)21)16(7-9)14-6-10(19)11(8-18)29-14/h5,7,10-12,14,18-19H,2,4,6,8,15H2,(H,25,26)(H,27,28)(H2,22,23,24)/t10-,11+,12?,14+/m0/s1 |
| InChIKey | BBMYAZACFFUKOH-PPSDRIHMSA-N |
| XLogP | -0.20 |
| TPSA | 283.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|