C12H18N3O14P3 — CID 90449181
[[(2R,3S,5R)-5-[4-(3-aminoprop-1-ynyl)-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90449181) has the molecular formula C12H18N3O14P3 and a molecular weight of 521.21 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-(3-aminoprop-1-ynyl)-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-(3-aminoprop-1-ynyl)-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90449181 |
| Molecular Formula | C12H18N3O14P3 |
| Molecular Weight | 521.21 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-(3-aminoprop-1-ynyl)-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c1 |
| InChI | InChI=1S/C12H18N3O14P3/c13-3-1-2-8-4-11(15(17)18)14(6-8)12-5-9(16)10(27-12)7-26-31(22,23)29-32(24,25)28-30(19,20)21/h4,6,9-10,12,16H,3,5,7,13H2,(H,22,23)(H,24,25)(H2,19,20,21)/t9-,10+,12+/m0/s1 |
| InChIKey | DMWMAEOYBVYIQM-HOSYDEDBSA-N |
| XLogP | -0.30 |
| TPSA | 263.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|