C23H27ClN4O5S — CID 90449234
ethyl 4-[1'-acetyl-1-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-5-yl]oxybutanoate (PubChem CID 90449234) has the molecular formula C23H27ClN4O5S and a molecular weight of 507.01 g/mol. Its IUPAC name is ethyl 4-[1'-acetyl-1-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-5-yl]oxybutanoate.
| Compound Name | ethyl 4-[1'-acetyl-1-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-5-yl]oxybutanoate |
|---|---|
| PubChem CID | 90449234 |
| Molecular Formula | C23H27ClN4O5S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | ethyl 4-[1'-acetyl-1-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-5-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOc1ccc2c(c1)C1(CCN(C(C)=O)C1)CN2C(=O)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C23H27ClN4O5S/c1-3-32-20(30)5-4-10-33-16-6-7-18-17(11-16)23(8-9-27(13-23)15(2)29)14-28(18)22(31)26-21-25-12-19(24)34-21/h6-7,11-12H,3-5,8-10,13-14H2,1-2H3,(H,25,26,31) |
| InChIKey | ZSSAXKASTOZSSK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|