C26H32ClN5O6S2 — CID 90449314
methyl 5-chloro-1-[[5-[4-(oxan-2-yloxyamino)-4-oxobutyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 90449314) has the molecular formula C26H32ClN5O6S2 and a molecular weight of 610.16 g/mol. Its IUPAC name is methyl 5-chloro-1-[[5-[4-(oxan-2-yloxyamino)-4-oxobutyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | methyl 5-chloro-1-[[5-[4-(oxan-2-yloxyamino)-4-oxobutyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 90449314 |
| Molecular Formula | C26H32ClN5O6S2 |
| Molecular Weight | 610.16 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | methyl 5-chloro-1-[[5-[4-(oxan-2-yloxyamino)-4-oxobutyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | COC(=O)N1CCC2(C1)CN(C(=O)Nc1ncc(SCCCC(=O)NOC3CCCCO3)s1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C26H32ClN5O6S2/c1-36-25(35)31-10-9-26(15-31)16-32(19-8-7-17(27)13-18(19)26)24(34)29-23-28-14-22(40-23)39-12-4-5-20(33)30-38-21-6-2-3-11-37-21/h7-8,13-14,21H,2-6,9-12,15-16H2,1H3,(H,30,33)(H,28,29,34) |
| InChIKey | IEXXMSXKVWKJLL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|