C16H22N3O17P3 — CID 90449318
4-[3-[1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-4-oxobutanoic acid (PubChem CID 90449318) has the molecular formula C16H22N3O17P3 and a molecular weight of 621.28 g/mol. Its IUPAC name is 4-[3-[1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90449318 |
| Molecular Formula | C16H22N3O17P3 |
| Molecular Weight | 621.28 g/mol |
| Exact Mass | 621.02 |
| IUPAC Name | 4-[3-[1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c1 |
| InChI | InChI=1S/C16H22N3O17P3/c20-11-7-15(34-12(11)9-33-38(29,30)36-39(31,32)35-37(26,27)28)18-8-10(6-14(18)19(24)25)2-1-5-17-13(21)3-4-16(22)23/h6,8,11-12,15,20H,3-5,7,9H2,(H,17,21)(H,22,23)(H,29,30)(H,31,32)(H2,26,27,28)/t11-,12+,15+/m0/s1 |
| InChIKey | QINKLTHAECKHJS-YWPYICTPSA-N |
| XLogP | -0.28 |
| TPSA | 303.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|