About 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde
6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde (PubChem CID 90449355) has the molecular formula C11H9N3O2
and a molecular weight of 215.21 g/mol. Its IUPAC name is 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde |
| PubChem CID | 90449355 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(-c2noc(C3CC3)n2)nc1 |
| InChI | InChI=1S/C11H9N3O2/c15-6-7-1-4-9(12-5-7)10-13-11(16-14-10)8-2-3-8/h1,4-6,8H,2-3H2 |
| InChIKey | YBUZCDDHTXFNSW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde?
The IUPAC name of 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde (CID 90449355) is 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde.
What is the SMILES notation for 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde?
The canonical SMILES for 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde is O=Cc1ccc(-c2noc(C3CC3)n2)nc1.
What is the InChIKey of 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde?
The InChIKey is YBUZCDDHTXFNSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2/c15-6-7-1-4-9(12-5-7)10-13-11(16-14-10)8-2-3-8/h1,4-6,8H,2-3H2.
What are the key properties of 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde?
6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde has a molecular weight of 215.21 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyridine-3-carbaldehyde is sourced from PubChem (CID 90449355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).