C20H24ClN5O5S2 — CID 90449579
1'-acetyl-N-(5-chloro-1,3-thiazol-2-yl)-5-(2-methoxyethylsulfamoyl)spiro[2H-indole-3,3'-pyrrolidine]-1-carboxamide (PubChem CID 90449579) has the molecular formula C20H24ClN5O5S2 and a molecular weight of 514.03 g/mol. Its IUPAC name is 1'-acetyl-N-(5-chloro-1,3-thiazol-2-yl)-5-(2-methoxyethylsulfamoyl)spiro[2H-indole-3,3'-pyrrolidine]-1-carboxamide.
| Compound Name | 1'-acetyl-N-(5-chloro-1,3-thiazol-2-yl)-5-(2-methoxyethylsulfamoyl)spiro[2H-indole-3,3'-pyrrolidine]-1-carboxamide |
|---|---|
| PubChem CID | 90449579 |
| Molecular Formula | C20H24ClN5O5S2 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 1'-acetyl-N-(5-chloro-1,3-thiazol-2-yl)-5-(2-methoxyethylsulfamoyl)spiro[2H-indole-3,3'-pyrrolidine]-1-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc2c(c1)C1(CCN(C(C)=O)C1)CN2C(=O)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C20H24ClN5O5S2/c1-13(27)25-7-5-20(11-25)12-26(19(28)24-18-22-10-17(21)32-18)16-4-3-14(9-15(16)20)33(29,30)23-6-8-31-2/h3-4,9-10,23H,5-8,11-12H2,1-2H3,(H,22,24,28) |
| InChIKey | BGBAFCIKKPRXHF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|