About 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid
5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid (PubChem CID 90449913) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid |
| PubChem CID | 90449913 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid |
| SMILES | O=C(O)N1CCC2(CNc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-8-1-2-10-9(5-8)12(6-14-10)3-4-15(7-12)11(16)17/h1-2,5,14H,3-4,6-7H2,(H,16,17) |
| InChIKey | SJCPOQMOCOMWCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid?
The IUPAC name of 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid (CID 90449913) is 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid.
What is the SMILES notation for 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid?
The canonical SMILES for 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid is O=C(O)N1CCC2(CNc3ccc(Cl)cc32)C1.
What is the InChIKey of 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid?
The InChIKey is SJCPOQMOCOMWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2/c13-8-1-2-10-9(5-8)12(6-14-10)3-4-15(7-12)11(16)17/h1-2,5,14H,3-4,6-7H2,(H,16,17).
What are the key properties of 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid?
5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid has a molecular weight of 252.70 g/mol, XLogP of 2.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylic acid is sourced from PubChem (CID 90449913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).