C31H38N3O7+ — CID 90450292
1-(2-acetyloxyethyl)-2-methyl-1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-1-ium-4,4-dicarboxylic acid (PubChem CID 90450292) has the molecular formula C31H38N3O7+ and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-(2-acetyloxyethyl)-2-methyl-1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-1-ium-4,4-dicarboxylic acid.
| Compound Name | 1-(2-acetyloxyethyl)-2-methyl-1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-1-ium-4,4-dicarboxylic acid |
|---|---|
| PubChem CID | 90450292 |
| Molecular Formula | C31H38N3O7+ |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 1-(2-acetyloxyethyl)-2-methyl-1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-1-ium-4,4-dicarboxylic acid |
| SMILES | CC(=O)OCC[N+]1(Cc2ccc(-c3noc(-c4ccc(CC(C)C)cc4)n3)cc2)CCC(C(=O)O)(C(=O)O)CC1C |
| InChI | InChI=1S/C31H37N3O7/c1-20(2)17-23-5-11-26(12-6-23)28-32-27(33-41-28)25-9-7-24(8-10-25)19-34(15-16-40-22(4)35)14-13-31(29(36)37,30(38)39)18-21(34)3/h5-12,20-21H,13-19H2,1-4H3,(H-,36,37,38,39)/p+1 |
| InChIKey | UPQWMWMWAIIVGP-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|