C21H31F3O3S — CID 90450655
[(3aR,5aS,6aR,8R,10aR,11aS,11bR)-3a,6a,8-trimethyl-4,5,5a,6,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate (PubChem CID 90450655) has the molecular formula C21H31F3O3S and a molecular weight of 420.54 g/mol. Its IUPAC name is [(3aR,5aS,6aR,8R,10aR,11aS,11bR)-3a,6a,8-trimethyl-4,5,5a,6,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,5aS,6aR,8R,10aR,11aS,11bR)-3a,6a,8-trimethyl-4,5,5a,6,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90450655 |
| Molecular Formula | C21H31F3O3S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [(3aR,5aS,6aR,8R,10aR,11aS,11bR)-3a,6a,8-trimethyl-4,5,5a,6,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1CC[C@@H]2C[C@H]3[C@@H](CC[C@@]4(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@H]34)C[C@@]2(C)C1 |
| InChI | InChI=1S/C21H31F3O3S/c1-13-4-5-15-10-16-14(12-19(15,2)11-13)8-9-20(3)17(16)6-7-18(20)27-28(25,26)21(22,23)24/h7,13-17H,4-6,8-12H2,1-3H3/t13-,14+,15-,16+,17-,19-,20-/m1/s1 |
| InChIKey | FAPCGXWXBUVSEI-SKSNXLECSA-N |
| XLogP | 6.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|