About [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate
[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate (PubChem CID 90450759) has the molecular formula C16H28O6
and a molecular weight of 316.39 g/mol. Its IUPAC name is [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate.
Molecular Properties
| Compound Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate |
| PubChem CID | 90450759 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)OCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C16H28O6/c1-2-3-4-5-6-7-8-9-14(19)21-11-13(18)16-15(20)12(17)10-22-16/h2,12-13,15-18,20H,1,3-11H2 |
| InChIKey | IXCNCQJMDWROQQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate?
The IUPAC name of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate (CID 90450759) is [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate.
What is the SMILES notation for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate?
The canonical SMILES for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate is C=CCCCCCCCC(=O)OCC(O)C1OCC(O)C1O.
What is the InChIKey of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate?
The InChIKey is IXCNCQJMDWROQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O6/c1-2-3-4-5-6-7-8-9-14(19)21-11-13(18)16-15(20)12(17)10-22-16/h2,12-13,15-18,20H,1,3-11H2.
What are the key properties of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate?
[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate has a molecular weight of 316.39 g/mol, XLogP of 0.93, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate is sourced from PubChem (CID 90450759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).