C19H26N4O4S — CID 90450910
2-[4-(carboxymethyl)-5-[(4-isothiocyanatophenyl)methyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 90450910) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-5-[(4-isothiocyanatophenyl)methyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-5-[(4-isothiocyanatophenyl)methyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 90450910 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[4-(carboxymethyl)-5-[(4-isothiocyanatophenyl)methyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CN1CCN(CC(=O)O)CCN(CC(=O)O)C(Cc2ccc(N=C=S)cc2)C1 |
| InChI | InChI=1S/C19H26N4O4S/c1-21-6-7-22(12-18(24)25)8-9-23(13-19(26)27)17(11-21)10-15-2-4-16(5-3-15)20-14-28/h2-5,17H,6-13H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | FCQPSWKHOBYEHB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|