C21H31F3O5S — CID 90450965
[(3aS,5aR,6aR,8S,10aS,11aR,11bS)-8-(methoxymethoxy)-3a-methyl-1,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydrocyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate (PubChem CID 90450965) has the molecular formula C21H31F3O5S and a molecular weight of 452.54 g/mol. Its IUPAC name is [(3aS,5aR,6aR,8S,10aS,11aR,11bS)-8-(methoxymethoxy)-3a-methyl-1,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydrocyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,5aR,6aR,8S,10aS,11aR,11bS)-8-(methoxymethoxy)-3a-methyl-1,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydrocyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90450965 |
| Molecular Formula | C21H31F3O5S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(3aS,5aR,6aR,8S,10aS,11aR,11bS)-8-(methoxymethoxy)-3a-methyl-1,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydrocyclopenta[a]anthracen-3-yl] trifluoromethanesulfonate |
| SMILES | COCO[C@H]1CC[C@H]2C[C@@H]3[C@H](CC[C@]4(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]34)C[C@@H]2C1 |
| InChI | InChI=1S/C21H31F3O5S/c1-20-8-7-14-9-15-10-16(28-12-27-2)4-3-13(15)11-17(14)18(20)5-6-19(20)29-30(25,26)21(22,23)24/h6,13-18H,3-5,7-12H2,1-2H3/t13-,14+,15+,16-,17+,18-,20-/m0/s1 |
| InChIKey | GWMCMBBPKIGTPM-GIPXKHMCSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|