About methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate
methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate (PubChem CID 90450982) has the molecular formula C15H10Cl2FN3O2
and a molecular weight of 354.17 g/mol. Its IUPAC name is methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| PubChem CID | 90450982 |
| Molecular Formula | C15H10Cl2FN3O2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3cc[nH]c3c2F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C15H10Cl2FN3O2/c1-23-15(22)14-9(17)11(19)8(16)13(21-14)7-3-2-6-4-5-20-12(6)10(7)18/h2-5,20H,1H3,(H2,19,21) |
| InChIKey | NLSYBWCTLTVCTI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate (CID 90450982) is methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate is COC(=O)c1nc(-c2ccc3cc[nH]c3c2F)c(Cl)c(N)c1Cl.
What is the InChIKey of methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The InChIKey is NLSYBWCTLTVCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2FN3O2/c1-23-15(22)14-9(17)11(19)8(16)13(21-14)7-3-2-6-4-5-20-12(6)10(7)18/h2-5,20H,1H3,(H2,19,21).
What are the key properties of methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate?
methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate has a molecular weight of 354.17 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,5-dichloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate is sourced from PubChem (CID 90450982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).