C10H17NO — CID 90451350
1-(2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridin-1-yl)ethanone (PubChem CID 90451350) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridin-1-yl)ethanone.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 90451350 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridin-1-yl)ethanone |
| SMILES | CC(=O)C1NCCC2CCCC21 |
| InChI | InChI=1S/C10H17NO/c1-7(12)10-9-4-2-3-8(9)5-6-11-10/h8-11H,2-6H2,1H3 |
| InChIKey | JYZHZBREXGKJLE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |