About N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine
N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine (PubChem CID 90452814) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine |
| PubChem CID | 90452814 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine |
| SMILES | CCNC1N=CNC=C1C |
| InChI | InChI=1S/C7H13N3/c1-3-9-7-6(2)4-8-5-10-7/h4-5,7,9H,3H2,1-2H3,(H,8,10) |
| InChIKey | CWMCVSUPEGTXNG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine?
The IUPAC name of N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine (CID 90452814) is N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine.
What is the SMILES notation for N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine?
The canonical SMILES for N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine is CCNC1N=CNC=C1C.
What is the InChIKey of N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine?
The InChIKey is CWMCVSUPEGTXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-9-7-6(2)4-8-5-10-7/h4-5,7,9H,3H2,1-2H3,(H,8,10).
What are the key properties of N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine?
N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine has a molecular weight of 139.20 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-methyl-1,4-dihydropyrimidin-4-amine is sourced from PubChem (CID 90452814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).