About N,5-dimethyl-1,4-dihydropyrimidin-4-amine
N,5-dimethyl-1,4-dihydropyrimidin-4-amine (PubChem CID 90452820) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is N,5-dimethyl-1,4-dihydropyrimidin-4-amine.
Molecular Properties
| Compound Name | N,5-dimethyl-1,4-dihydropyrimidin-4-amine |
| PubChem CID | 90452820 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | N,5-dimethyl-1,4-dihydropyrimidin-4-amine |
| SMILES | CNC1N=CNC=C1C |
| InChI | InChI=1S/C6H11N3/c1-5-3-8-4-9-6(5)7-2/h3-4,6-7H,1-2H3,(H,8,9) |
| InChIKey | LKZAELNQBGOTPQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,5-dimethyl-1,4-dihydropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-1,4-dihydropyrimidin-4-amine?
The IUPAC name of N,5-dimethyl-1,4-dihydropyrimidin-4-amine (CID 90452820) is N,5-dimethyl-1,4-dihydropyrimidin-4-amine.
What is the SMILES notation for N,5-dimethyl-1,4-dihydropyrimidin-4-amine?
The canonical SMILES for N,5-dimethyl-1,4-dihydropyrimidin-4-amine is CNC1N=CNC=C1C.
What is the InChIKey of N,5-dimethyl-1,4-dihydropyrimidin-4-amine?
The InChIKey is LKZAELNQBGOTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-5-3-8-4-9-6(5)7-2/h3-4,6-7H,1-2H3,(H,8,9).
What are the key properties of N,5-dimethyl-1,4-dihydropyrimidin-4-amine?
N,5-dimethyl-1,4-dihydropyrimidin-4-amine has a molecular weight of 125.17 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-1,4-dihydropyrimidin-4-amine is sourced from PubChem (CID 90452820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).