About N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine
N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine (PubChem CID 90452854) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine |
| PubChem CID | 90452854 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine |
| SMILES | CCOCNc1ncnc(C)c1C |
| InChI | InChI=1S/C9H15N3O/c1-4-13-6-12-9-7(2)8(3)10-5-11-9/h5H,4,6H2,1-3H3,(H,10,11,12) |
| InChIKey | XVSBEKCIYDNPJP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine?
The IUPAC name of N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine (CID 90452854) is N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine?
The canonical SMILES for N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine is CCOCNc1ncnc(C)c1C.
What is the InChIKey of N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine?
The InChIKey is XVSBEKCIYDNPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-4-13-6-12-9-7(2)8(3)10-5-11-9/h5H,4,6H2,1-3H3,(H,10,11,12).
What are the key properties of N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine?
N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine has a molecular weight of 181.24 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(ethoxymethyl)-5,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 90452854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).