C17H18F5N5S2 — CID 90453135
4-[4-(5,5-dimethyl-4H-1,3-thiazol-2-yl)piperazin-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 90453135) has the molecular formula C17H18F5N5S2 and a molecular weight of 451.49 g/mol. Its IUPAC name is 4-[4-(5,5-dimethyl-4H-1,3-thiazol-2-yl)piperazin-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(5,5-dimethyl-4H-1,3-thiazol-2-yl)piperazin-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 90453135 |
| Molecular Formula | C17H18F5N5S2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 4-[4-(5,5-dimethyl-4H-1,3-thiazol-2-yl)piperazin-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | CC1(C)CN=C(N2CCN(c3ncnc4sc(C(F)(F)C(F)(F)F)cc34)CC2)S1 |
| InChI | InChI=1S/C17H18F5N5S2/c1-15(2)8-23-14(29-15)27-5-3-26(4-6-27)12-10-7-11(16(18,19)17(20,21)22)28-13(10)25-9-24-12/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | GFFCPACLFKCZTI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|