C15H14F4N6S2 — CID 90453138
4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-6-(1,2,2,2-tetrafluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 90453138) has the molecular formula C15H14F4N6S2 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-6-(1,2,2,2-tetrafluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-6-(1,2,2,2-tetrafluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 90453138 |
| Molecular Formula | C15H14F4N6S2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-6-(1,2,2,2-tetrafluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1nnc(N2CCN(c3ncnc4sc(C(F)C(F)(F)F)cc34)CC2)s1 |
| InChI | InChI=1S/C15H14F4N6S2/c1-8-22-23-14(26-8)25-4-2-24(3-5-25)12-9-6-10(11(16)15(17,18)19)27-13(9)21-7-20-12/h6-7,11H,2-5H2,1H3 |
| InChIKey | UNCJGQZLVPQPIV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |