About 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol
2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol (PubChem CID 90453145) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol |
| PubChem CID | 90453145 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol |
| SMILES | CNC(O)C(C)Nc1ncnc(C)c1C |
| InChI | InChI=1S/C10H18N4O/c1-6-7(2)12-5-13-9(6)14-8(3)10(15)11-4/h5,8,10-11,15H,1-4H3,(H,12,13,14) |
| InChIKey | UUHQVBYBJOZWMY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol?
The IUPAC name of 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol (CID 90453145) is 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol.
What is the SMILES notation for 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol?
The canonical SMILES for 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol is CNC(O)C(C)Nc1ncnc(C)c1C.
What is the InChIKey of 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol?
The InChIKey is UUHQVBYBJOZWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-6-7(2)12-5-13-9(6)14-8(3)10(15)11-4/h5,8,10-11,15H,1-4H3,(H,12,13,14).
What are the key properties of 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol?
2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol has a molecular weight of 210.28 g/mol, XLogP of 0.43, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethylpyrimidin-4-yl)amino]-1-(methylamino)propan-1-ol is sourced from PubChem (CID 90453145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).