C23H24F3N5O3S2 — CID 90453151
[4-[2-oxo-2-[(1S,4S)-5-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octan-2-yl]ethyl]phenyl]methanesulfonamide (PubChem CID 90453151) has the molecular formula C23H24F3N5O3S2 and a molecular weight of 539.61 g/mol. Its IUPAC name is [4-[2-oxo-2-[(1S,4S)-5-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octan-2-yl]ethyl]phenyl]methanesulfonamide.
| Compound Name | [4-[2-oxo-2-[(1S,4S)-5-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octan-2-yl]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90453151 |
| Molecular Formula | C23H24F3N5O3S2 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [4-[2-oxo-2-[(1S,4S)-5-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octan-2-yl]ethyl]phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(CC(=O)N2C[C@@H]3CC[C@H]2CN3c2ncnc3sc(CC(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C23H24F3N5O3S2/c24-23(25,26)9-18-8-19-21(28-13-29-22(19)35-18)31-11-16-5-6-17(31)10-30(16)20(32)7-14-1-3-15(4-2-14)12-36(27,33)34/h1-4,8,13,16-17H,5-7,9-12H2,(H2,27,33,34)/t16-,17-/m0/s1 |
| InChIKey | SQUYBXVEXKKZBA-IRXDYDNUSA-N |
| XLogP | 3.01 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |