C25H30F3N5S — CID 90453204
N-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 90453204) has the molecular formula C25H30F3N5S and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90453204 |
| Molecular Formula | C25H30F3N5S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)Cc1cc2c(NC3CCN(Cc4ccc(N5CCCCC5)cc4)CC3)ncnc2s1 |
| InChI | InChI=1S/C25H30F3N5S/c26-25(27,28)15-21-14-22-23(29-17-30-24(22)34-21)31-19-8-12-32(13-9-19)16-18-4-6-20(7-5-18)33-10-2-1-3-11-33/h4-7,14,17,19H,1-3,8-13,15-16H2,(H,29,30,31) |
| InChIKey | FHMVJFIWPDFHND-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|