About (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine
(Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine (PubChem CID 90453242) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine |
| PubChem CID | 90453242 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine |
| SMILES | C=N/C(=C\C(C)N)NC |
| InChI | InChI=1S/C6H13N3/c1-5(7)4-6(8-2)9-3/h4-5,9H,2,7H2,1,3H3/b6-4+ |
| InChIKey | BLQKZTRYNPDUFC-GQCTYLIASA-N |
| XLogP | 0.09 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine?
The IUPAC name of (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine (CID 90453242) is (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine.
What is the SMILES notation for (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine?
The canonical SMILES for (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine is C=N/C(=C\C(C)N)NC.
What is the InChIKey of (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine?
The InChIKey is BLQKZTRYNPDUFC-GQCTYLIASA-N. The full InChI is InChI=1S/C6H13N3/c1-5(7)4-6(8-2)9-3/h4-5,9H,2,7H2,1,3H3/b6-4+.
What are the key properties of (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine?
(Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine has a molecular weight of 127.19 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-methyl-1-(methylideneamino)but-1-ene-1,3-diamine is sourced from PubChem (CID 90453242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).