C15H22N6O — CID 90453423
N-[(1Z,4E)-5-(ethylaminooxy)-3-imino-2-methyl-1-(methylideneamino)hexa-1,4-dienyl]-N-methylpyrimidin-5-amine (PubChem CID 90453423) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[(1Z,4E)-5-(ethylaminooxy)-3-imino-2-methyl-1-(methylideneamino)hexa-1,4-dienyl]-N-methylpyrimidin-5-amine.
| Compound Name | N-[(1Z,4E)-5-(ethylaminooxy)-3-imino-2-methyl-1-(methylideneamino)hexa-1,4-dienyl]-N-methylpyrimidin-5-amine |
|---|---|
| PubChem CID | 90453423 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[(1Z,4E)-5-(ethylaminooxy)-3-imino-2-methyl-1-(methylideneamino)hexa-1,4-dienyl]-N-methylpyrimidin-5-amine |
| SMILES | [H]/N=C(\C=C(/C)ONCC)C(/C)=C(\N=C)N(C)c1cncnc1 |
| InChI | InChI=1S/C15H22N6O/c1-6-20-22-11(2)7-14(16)12(3)15(17-4)21(5)13-8-18-10-19-9-13/h7-10,16,20H,4,6H2,1-3,5H3/b11-7+,15-12+,16-14+ |
| InChIKey | HHRYCAIPLANRDQ-LMGHWLQNSA-N |
| XLogP | 2.31 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|