C10H19N3 — CID 90453474
(1Z)-1-N-ethyl-1-N,2-dimethyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine (PubChem CID 90453474) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1Z)-1-N-ethyl-1-N,2-dimethyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine.
| Compound Name | (1Z)-1-N-ethyl-1-N,2-dimethyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 90453474 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1Z)-1-N-ethyl-1-N,2-dimethyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine |
| SMILES | C=CC(N)/C(C)=C(\N=C)N(C)CC |
| InChI | InChI=1S/C10H19N3/c1-6-9(11)8(3)10(12-4)13(5)7-2/h6,9H,1,4,7,11H2,2-3,5H3/b10-8+ |
| InChIKey | LZEGDIMSVVXRFY-CSKARUKUSA-N |
| XLogP | 1.38 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|