C8H13N3O2S — CID 90453643
2-methyl-3-(2-methylpropylsulfanyl)-1H-1,2,4-triazine-5,6-dione (PubChem CID 90453643) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-methyl-3-(2-methylpropylsulfanyl)-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-(2-methylpropylsulfanyl)-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 90453643 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-methyl-3-(2-methylpropylsulfanyl)-1H-1,2,4-triazine-5,6-dione |
| SMILES | CC(C)CSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C8H13N3O2S/c1-5(2)4-14-8-9-6(12)7(13)10-11(8)3/h5H,4H2,1-3H3,(H,10,13) |
| InChIKey | MPGXHHYSNRXRKN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|