C9H17N3 — CID 90453691
(1Z,4Z)-1-N,2-dimethyl-1-(methylideneamino)hexa-1,4-diene-1,3-diamine (PubChem CID 90453691) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (1Z,4Z)-1-N,2-dimethyl-1-(methylideneamino)hexa-1,4-diene-1,3-diamine.
| Compound Name | (1Z,4Z)-1-N,2-dimethyl-1-(methylideneamino)hexa-1,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 90453691 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (1Z,4Z)-1-N,2-dimethyl-1-(methylideneamino)hexa-1,4-diene-1,3-diamine |
| SMILES | C=N/C(NC)=C(/C)C(N)/C=C\C |
| InChI | InChI=1S/C9H17N3/c1-5-6-8(10)7(2)9(11-3)12-4/h5-6,8,12H,3,10H2,1-2,4H3/b6-5-,9-7+ |
| InChIKey | DIPYCRRGAFWFLY-BZWSEGBZSA-N |
| XLogP | 1.04 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|