About (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine
(1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine (PubChem CID 90453860) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine.
Molecular Properties
| Compound Name | (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine |
| PubChem CID | 90453860 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine |
| SMILES | C=CC(N)/C(C)=C(\N=C)NCC |
| InChI | InChI=1S/C9H17N3/c1-5-8(10)7(3)9(11-4)12-6-2/h5,8,12H,1,4,6,10H2,2-3H3/b9-7+ |
| InChIKey | GHEZAVZJPQQRKZ-VQHVLOKHSA-N |
| XLogP | 1.04 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine?
The IUPAC name of (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine (CID 90453860) is (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine.
What is the SMILES notation for (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine?
The canonical SMILES for (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine is C=CC(N)/C(C)=C(\N=C)NCC.
What is the InChIKey of (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine?
The InChIKey is GHEZAVZJPQQRKZ-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H17N3/c1-5-8(10)7(3)9(11-4)12-6-2/h5,8,12H,1,4,6,10H2,2-3H3/b9-7+.
What are the key properties of (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine?
(1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine has a molecular weight of 167.26 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-N-ethyl-2-methyl-1-(methylideneamino)penta-1,4-diene-1,3-diamine is sourced from PubChem (CID 90453860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).