C10H18FN3 — CID 90453933
N'-[(1E,4Z)-1-(2-fluoroethylamino)-2-methylhexa-1,4-dien-3-yl]methanimidamide (PubChem CID 90453933) has the molecular formula C10H18FN3 and a molecular weight of 199.27 g/mol. Its IUPAC name is N'-[(1E,4Z)-1-(2-fluoroethylamino)-2-methylhexa-1,4-dien-3-yl]methanimidamide.
| Compound Name | N'-[(1E,4Z)-1-(2-fluoroethylamino)-2-methylhexa-1,4-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 90453933 |
| Molecular Formula | C10H18FN3 |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | N'-[(1E,4Z)-1-(2-fluoroethylamino)-2-methylhexa-1,4-dien-3-yl]methanimidamide |
| SMILES | C/C=C\C(/N=C/N)/C(C)=C/NCCF |
| InChI | InChI=1S/C10H18FN3/c1-3-4-10(14-8-12)9(2)7-13-6-5-11/h3-4,7-8,10,13H,5-6H2,1-2H3,(H2,12,14)/b4-3-,9-7+ |
| InChIKey | PGPOYFDXMDTPPV-GAWLIRPZSA-N |
| XLogP | 1.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|