About 5,6-dimethyl-1,4-dihydropyrimidin-4-amine
5,6-dimethyl-1,4-dihydropyrimidin-4-amine (PubChem CID 90453936) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5,6-dimethyl-1,4-dihydropyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dimethyl-1,4-dihydropyrimidin-4-amine |
| PubChem CID | 90453936 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 5,6-dimethyl-1,4-dihydropyrimidin-4-amine |
| SMILES | CC1=C(C)C(N)N=CN1 |
| InChI | InChI=1S/C6H11N3/c1-4-5(2)8-3-9-6(4)7/h3,6H,7H2,1-2H3,(H,8,9) |
| InChIKey | NIJHPGAJYRHBNI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethyl-1,4-dihydropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1,4-dihydropyrimidin-4-amine?
The IUPAC name of 5,6-dimethyl-1,4-dihydropyrimidin-4-amine (CID 90453936) is 5,6-dimethyl-1,4-dihydropyrimidin-4-amine.
What is the SMILES notation for 5,6-dimethyl-1,4-dihydropyrimidin-4-amine?
The canonical SMILES for 5,6-dimethyl-1,4-dihydropyrimidin-4-amine is CC1=C(C)C(N)N=CN1.
What is the InChIKey of 5,6-dimethyl-1,4-dihydropyrimidin-4-amine?
The InChIKey is NIJHPGAJYRHBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-4-5(2)8-3-9-6(4)7/h3,6H,7H2,1-2H3,(H,8,9).
What are the key properties of 5,6-dimethyl-1,4-dihydropyrimidin-4-amine?
5,6-dimethyl-1,4-dihydropyrimidin-4-amine has a molecular weight of 125.17 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1,4-dihydropyrimidin-4-amine is sourced from PubChem (CID 90453936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).