About N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide
N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide (PubChem CID 90453984) has the molecular formula C10H23N5
and a molecular weight of 213.33 g/mol. Its IUPAC name is N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide |
| PubChem CID | 90453984 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(=C(/C)CN)N(C)CCNC |
| InChI | InChI=1S/C10H23N5/c1-9(7-11)10(14-8-13-3)15(4)6-5-12-2/h8,12H,5-7,11H2,1-4H3,(H,13,14)/b10-9+ |
| InChIKey | IOBPXDJOOZIHFI-MDZDMXLPSA-N |
| XLogP | -0.42 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide?
The IUPAC name of N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide (CID 90453984) is N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide is C/N=C/N/C(=C(/C)CN)N(C)CCNC.
What is the InChIKey of N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide?
The InChIKey is IOBPXDJOOZIHFI-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H23N5/c1-9(7-11)10(14-8-13-3)15(4)6-5-12-2/h8,12H,5-7,11H2,1-4H3,(H,13,14)/b10-9+.
What are the key properties of N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide?
N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide has a molecular weight of 213.33 g/mol, XLogP of -0.42, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-amino-2-methyl-1-[methyl-[2-(methylamino)ethyl]amino]prop-1-enyl]-N'-methylmethanimidamide is sourced from PubChem (CID 90453984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).