C22H25FN6O3 — CID 90454092
5-fluoro-2-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]-1H-pyrimidin-6-one (PubChem CID 90454092) has the molecular formula C22H25FN6O3 and a molecular weight of 440.48 g/mol. Its IUPAC name is 5-fluoro-2-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-2-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 90454092 |
| Molecular Formula | C22H25FN6O3 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 5-fluoro-2-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)ncc1F |
| InChI | InChI=1S/C22H25FN6O3/c23-17-13-26-22(28-21(17)30)27-14-1-3-16(4-2-14)32-19-12-15(29-7-9-31-10-8-29)11-18-20(19)25-6-5-24-18/h5-6,11-14,16H,1-4,7-10H2,(H2,26,27,28,30) |
| InChIKey | UJKUUWPBNODQBF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |