C10H9N5O — CID 90454624
5-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-10-carbonitrile (PubChem CID 90454624) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 5-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-10-carbonitrile.
| Compound Name | 5-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-10-carbonitrile |
|---|---|
| PubChem CID | 90454624 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 5-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-10-carbonitrile |
| SMILES | CN1Cc2nc3c(C#N)c[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C10H9N5O/c1-14-4-7-8(5-14)13-9-6(2-11)3-12-15(9)10(7)16/h3,12H,4-5H2,1H3 |
| InChIKey | ASYUZGUYLUBWPF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |