C25H37NO4 — CID 90454897
7-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 90454897) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 90454897 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 7-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CC(CCCc1ccccc1)[C@@H](O)/C=C/[C@H]1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H37NO4/c1-20(10-9-13-21-11-5-4-6-12-21)23(27)17-15-22-16-18-24(28)26(22)19-8-3-2-7-14-25(29)30/h4-6,11-12,15,17,20,22-23,27H,2-3,7-10,13-14,16,18-19H2,1H3,(H,29,30)/b17-15+/t20?,22-,23-/m0/s1 |
| InChIKey | CHLXVWPOHSBADP-KMMAFYGUSA-N |
| XLogP | 4.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|